C42H49F3O5 — CID 14847580
6-O-[4-(4-decoxyphenyl)phenyl] 2-O-(1,1,1-trifluorooctan-2-yl) naphthalene-2,6-dicarboxylate (PubChem CID 14847580) has the molecular formula C42H49F3O5 and a molecular weight of 690.84 g/mol. Its IUPAC name is 6-O-[4-(4-decoxyphenyl)phenyl] 2-O-(1,1,1-trifluorooctan-2-yl) naphthalene-2,6-dicarboxylate.
| Compound Name | 6-O-[4-(4-decoxyphenyl)phenyl] 2-O-(1,1,1-trifluorooctan-2-yl) naphthalene-2,6-dicarboxylate |
|---|---|
| PubChem CID | 14847580 |
| Molecular Formula | C42H49F3O5 |
| Molecular Weight | 690.84 g/mol |
| Exact Mass | 690.35 |
| IUPAC Name | 6-O-[4-(4-decoxyphenyl)phenyl] 2-O-(1,1,1-trifluorooctan-2-yl) naphthalene-2,6-dicarboxylate |
| SMILES | CCCCCCCCCCOc1ccc(-c2ccc(OC(=O)c3ccc4cc(C(=O)OC(CCCCCC)C(F)(F)F)ccc4c3)cc2)cc1 |
| InChI | InChI=1S/C42H49F3O5/c1-3-5-7-9-10-11-12-14-28-48-37-24-20-31(21-25-37)32-22-26-38(27-23-32)49-40(46)35-18-16-34-30-36(19-17-33(34)29-35)41(47)50-39(42(43,44)45)15-13-8-6-4-2/h16-27,29-30,39H,3-15,28H2,1-2H3 |
| InChIKey | DKDLNMAGZWMTCT-UHFFFAOYSA-N |
| XLogP | 12.30 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.84 |
| LogP ≤ 5 | 12.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|