C36H43F3O4 — CID 14847908
[4-[(2S)-1,1,1-trifluorooctan-2-yl]oxycarbonylphenyl] 4-(4-octylphenyl)benzoate (PubChem CID 14847908) has the molecular formula C36H43F3O4 and a molecular weight of 596.73 g/mol. Its IUPAC name is [4-[(2S)-1,1,1-trifluorooctan-2-yl]oxycarbonylphenyl] 4-(4-octylphenyl)benzoate.
| Compound Name | [4-[(2S)-1,1,1-trifluorooctan-2-yl]oxycarbonylphenyl] 4-(4-octylphenyl)benzoate |
|---|---|
| PubChem CID | 14847908 |
| Molecular Formula | C36H43F3O4 |
| Molecular Weight | 596.73 g/mol |
| Exact Mass | 596.31 |
| IUPAC Name | [4-[(2S)-1,1,1-trifluorooctan-2-yl]oxycarbonylphenyl] 4-(4-octylphenyl)benzoate |
| SMILES | CCCCCCCCc1ccc(-c2ccc(C(=O)Oc3ccc(C(=O)O[C@@H](CCCCCC)C(F)(F)F)cc3)cc2)cc1 |
| InChI | InChI=1S/C36H43F3O4/c1-3-5-7-9-10-11-13-27-15-17-28(18-16-27)29-19-21-30(22-20-29)34(40)42-32-25-23-31(24-26-32)35(41)43-33(36(37,38)39)14-12-8-6-4-2/h15-26,33H,3-14H2,1-2H3/t33-/m0/s1 |
| InChIKey | DXUHCLBKWXQLBR-XIFFEERXSA-N |
| XLogP | 10.53 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.73 |
| LogP ≤ 5 | 10.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|