C34H39F3O5 — CID 14847909
[4-(1,1,1-trifluorooctan-2-yloxycarbonyl)phenyl] 4-(4-hexoxyphenyl)benzoate (PubChem CID 14847909) has the molecular formula C34H39F3O5 and a molecular weight of 584.68 g/mol. Its IUPAC name is [4-(1,1,1-trifluorooctan-2-yloxycarbonyl)phenyl] 4-(4-hexoxyphenyl)benzoate.
| Compound Name | [4-(1,1,1-trifluorooctan-2-yloxycarbonyl)phenyl] 4-(4-hexoxyphenyl)benzoate |
|---|---|
| PubChem CID | 14847909 |
| Molecular Formula | C34H39F3O5 |
| Molecular Weight | 584.68 g/mol |
| Exact Mass | 584.27 |
| IUPAC Name | [4-(1,1,1-trifluorooctan-2-yloxycarbonyl)phenyl] 4-(4-hexoxyphenyl)benzoate |
| SMILES | CCCCCCOc1ccc(-c2ccc(C(=O)Oc3ccc(C(=O)OC(CCCCCC)C(F)(F)F)cc3)cc2)cc1 |
| InChI | InChI=1S/C34H39F3O5/c1-3-5-7-9-11-31(34(35,36)37)42-33(39)28-18-22-30(23-19-28)41-32(38)27-14-12-25(13-15-27)26-16-20-29(21-17-26)40-24-10-8-6-4-2/h12-23,31H,3-11,24H2,1-2H3 |
| InChIKey | XUCLNGUOLKITQD-UHFFFAOYSA-N |
| XLogP | 9.59 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.68 |
| LogP ≤ 5 | 9.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|