About S-(2-ethylsulfanylethyl) prop-2-enethioate
S-(2-ethylsulfanylethyl) prop-2-enethioate (PubChem CID 14848354) has the molecular formula C7H12OS2
and a molecular weight of 176.31 g/mol. Its IUPAC name is S-(2-ethylsulfanylethyl) prop-2-enethioate.
Molecular Properties
| Compound Name | S-(2-ethylsulfanylethyl) prop-2-enethioate |
| PubChem CID | 14848354 |
| Molecular Formula | C7H12OS2 |
| Molecular Weight | 176.31 g/mol |
| Exact Mass | 176.03 |
| IUPAC Name | S-(2-ethylsulfanylethyl) prop-2-enethioate |
| SMILES | C=CC(=O)SCCSCC |
| InChI | InChI=1S/C7H12OS2/c1-3-7(8)10-6-5-9-4-2/h3H,1,4-6H2,2H3 |
| InChIKey | JKVCEQLHPWNCKA-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.31 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-(2-ethylsulfanylethyl) prop-2-enethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-(2-ethylsulfanylethyl) prop-2-enethioate?
The IUPAC name of S-(2-ethylsulfanylethyl) prop-2-enethioate (CID 14848354) is S-(2-ethylsulfanylethyl) prop-2-enethioate.
What is the SMILES notation for S-(2-ethylsulfanylethyl) prop-2-enethioate?
The canonical SMILES for S-(2-ethylsulfanylethyl) prop-2-enethioate is C=CC(=O)SCCSCC.
What is the InChIKey of S-(2-ethylsulfanylethyl) prop-2-enethioate?
The InChIKey is JKVCEQLHPWNCKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12OS2/c1-3-7(8)10-6-5-9-4-2/h3H,1,4-6H2,2H3.
What are the key properties of S-(2-ethylsulfanylethyl) prop-2-enethioate?
S-(2-ethylsulfanylethyl) prop-2-enethioate has a molecular weight of 176.31 g/mol, XLogP of 2.19, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for S-(2-ethylsulfanylethyl) prop-2-enethioate is sourced from PubChem (CID 14848354), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).