About 4-(4-hydroxy-2,5-dimethylphenyl)sulfonyl-2,5-dimethylphenol
4-(4-hydroxy-2,5-dimethylphenyl)sulfonyl-2,5-dimethylphenol (PubChem CID 14848723) has the molecular formula C16H18O4S
and a molecular weight of 306.38 g/mol. Its IUPAC name is 4-(4-hydroxy-2,5-dimethylphenyl)sulfonyl-2,5-dimethylphenol.
Molecular Properties
| Compound Name | 4-(4-hydroxy-2,5-dimethylphenyl)sulfonyl-2,5-dimethylphenol |
| PubChem CID | 14848723 |
| Molecular Formula | C16H18O4S |
| Molecular Weight | 306.38 g/mol |
| Exact Mass | 306.09 |
| IUPAC Name | 4-(4-hydroxy-2,5-dimethylphenyl)sulfonyl-2,5-dimethylphenol |
| SMILES | Cc1cc(S(=O)(=O)c2cc(C)c(O)cc2C)c(C)cc1O |
| InChI | InChI=1S/C16H18O4S/c1-9-7-15(11(3)5-13(9)17)21(19,20)16-8-10(2)14(18)6-12(16)4/h5-8,17-18H,1-4H3 |
| InChIKey | QVKJTLXSMQPTEU-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.38 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(4-hydroxy-2,5-dimethylphenyl)sulfonyl-2,5-dimethylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-hydroxy-2,5-dimethylphenyl)sulfonyl-2,5-dimethylphenol?
The IUPAC name of 4-(4-hydroxy-2,5-dimethylphenyl)sulfonyl-2,5-dimethylphenol (CID 14848723) is 4-(4-hydroxy-2,5-dimethylphenyl)sulfonyl-2,5-dimethylphenol.
What is the SMILES notation for 4-(4-hydroxy-2,5-dimethylphenyl)sulfonyl-2,5-dimethylphenol?
The canonical SMILES for 4-(4-hydroxy-2,5-dimethylphenyl)sulfonyl-2,5-dimethylphenol is Cc1cc(S(=O)(=O)c2cc(C)c(O)cc2C)c(C)cc1O.
What is the InChIKey of 4-(4-hydroxy-2,5-dimethylphenyl)sulfonyl-2,5-dimethylphenol?
The InChIKey is QVKJTLXSMQPTEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18O4S/c1-9-7-15(11(3)5-13(9)17)21(19,20)16-8-10(2)14(18)6-12(16)4/h5-8,17-18H,1-4H3.
What are the key properties of 4-(4-hydroxy-2,5-dimethylphenyl)sulfonyl-2,5-dimethylphenol?
4-(4-hydroxy-2,5-dimethylphenyl)sulfonyl-2,5-dimethylphenol has a molecular weight of 306.38 g/mol, XLogP of 3.16, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-hydroxy-2,5-dimethylphenyl)sulfonyl-2,5-dimethylphenol is sourced from PubChem (CID 14848723), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).