C28H23FN2O3 — CID 14848773
[4-(5-ethylpyrimidin-2-yl)-2-fluorophenyl] 4-(4-prop-2-enoxyphenyl)benzoate (PubChem CID 14848773) has the molecular formula C28H23FN2O3 and a molecular weight of 454.50 g/mol. Its IUPAC name is [4-(5-ethylpyrimidin-2-yl)-2-fluorophenyl] 4-(4-prop-2-enoxyphenyl)benzoate.
| Compound Name | [4-(5-ethylpyrimidin-2-yl)-2-fluorophenyl] 4-(4-prop-2-enoxyphenyl)benzoate |
|---|---|
| PubChem CID | 14848773 |
| Molecular Formula | C28H23FN2O3 |
| Molecular Weight | 454.50 g/mol |
| Exact Mass | 454.17 |
| IUPAC Name | [4-(5-ethylpyrimidin-2-yl)-2-fluorophenyl] 4-(4-prop-2-enoxyphenyl)benzoate |
| SMILES | C=CCOc1ccc(-c2ccc(C(=O)Oc3ccc(-c4ncc(CC)cn4)cc3F)cc2)cc1 |
| InChI | InChI=1S/C28H23FN2O3/c1-3-15-33-24-12-9-21(10-13-24)20-5-7-22(8-6-20)28(32)34-26-14-11-23(16-25(26)29)27-30-17-19(4-2)18-31-27/h3,5-14,16-18H,1,4,15H2,2H3 |
| InChIKey | FBYFCPHXIGGVDK-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 61.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.50 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|