About N-ethoxypropan-2-amine
N-ethoxypropan-2-amine (PubChem CID 14849020) has the molecular formula C5H13NO
and a molecular weight of 103.16 g/mol. Its IUPAC name is N-ethoxypropan-2-amine.
Molecular Properties
| Compound Name | N-ethoxypropan-2-amine |
| PubChem CID | 14849020 |
| Molecular Formula | C5H13NO |
| Molecular Weight | 103.16 g/mol |
| Exact Mass | 103.10 |
| IUPAC Name | N-ethoxypropan-2-amine |
| SMILES | CCONC(C)C |
| InChI | InChI=1S/C5H13NO/c1-4-7-6-5(2)3/h5-6H,4H2,1-3H3 |
| InChIKey | LOPMOJDYWCHTJL-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 103.16 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-ethoxypropan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethoxypropan-2-amine?
The IUPAC name of N-ethoxypropan-2-amine (CID 14849020) is N-ethoxypropan-2-amine.
What is the SMILES notation for N-ethoxypropan-2-amine?
The canonical SMILES for N-ethoxypropan-2-amine is CCONC(C)C.
What is the InChIKey of N-ethoxypropan-2-amine?
The InChIKey is LOPMOJDYWCHTJL-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H13NO/c1-4-7-6-5(2)3/h5-6H,4H2,1-3H3.
What are the key properties of N-ethoxypropan-2-amine?
N-ethoxypropan-2-amine has a molecular weight of 103.16 g/mol, XLogP of 0.94, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethoxypropan-2-amine is sourced from PubChem (CID 14849020), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).