About dipropan-2-yl cyclohexane-1,2-dicarboxylate
dipropan-2-yl cyclohexane-1,2-dicarboxylate (PubChem CID 14849275) has the molecular formula C14H24O4
and a molecular weight of 256.34 g/mol. Its IUPAC name is dipropan-2-yl cyclohexane-1,2-dicarboxylate.
Molecular Properties
| Compound Name | dipropan-2-yl cyclohexane-1,2-dicarboxylate |
| PubChem CID | 14849275 |
| Molecular Formula | C14H24O4 |
| Molecular Weight | 256.34 g/mol |
| Exact Mass | 256.17 |
| IUPAC Name | dipropan-2-yl cyclohexane-1,2-dicarboxylate |
| SMILES | CC(C)OC(=O)C1CCCCC1C(=O)OC(C)C |
| InChI | InChI=1S/C14H24O4/c1-9(2)17-13(15)11-7-5-6-8-12(11)14(16)18-10(3)4/h9-12H,5-8H2,1-4H3 |
| InChIKey | HFVJRYILMUSLFV-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.34 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze dipropan-2-yl cyclohexane-1,2-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dipropan-2-yl cyclohexane-1,2-dicarboxylate?
The IUPAC name of dipropan-2-yl cyclohexane-1,2-dicarboxylate (CID 14849275) is dipropan-2-yl cyclohexane-1,2-dicarboxylate.
What is the SMILES notation for dipropan-2-yl cyclohexane-1,2-dicarboxylate?
The canonical SMILES for dipropan-2-yl cyclohexane-1,2-dicarboxylate is CC(C)OC(=O)C1CCCCC1C(=O)OC(C)C.
What is the InChIKey of dipropan-2-yl cyclohexane-1,2-dicarboxylate?
The InChIKey is HFVJRYILMUSLFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24O4/c1-9(2)17-13(15)11-7-5-6-8-12(11)14(16)18-10(3)4/h9-12H,5-8H2,1-4H3.
What are the key properties of dipropan-2-yl cyclohexane-1,2-dicarboxylate?
dipropan-2-yl cyclohexane-1,2-dicarboxylate has a molecular weight of 256.34 g/mol, XLogP of 2.70, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dipropan-2-yl cyclohexane-1,2-dicarboxylate is sourced from PubChem (CID 14849275), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).