About dicyanocyanamide
dicyanocyanamide (PubChem CID 14849309) has the molecular formula C3N4
and a molecular weight of 92.06 g/mol. Its IUPAC name is dicyanocyanamide.
Molecular Properties
| Compound Name | dicyanocyanamide |
| PubChem CID | 14849309 |
| Molecular Formula | C3N4 |
| Molecular Weight | 92.06 g/mol |
| Exact Mass | 92.01 |
| IUPAC Name | dicyanocyanamide |
| SMILES | N#CN(C#N)C#N |
| InChI | InChI=1S/C3N4/c4-1-7(2-5)3-6 |
| InChIKey | ZXNYKOAICSPUKI-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 74.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 92.06 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|
Analyze dicyanocyanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dicyanocyanamide?
The IUPAC name of dicyanocyanamide (CID 14849309) is dicyanocyanamide.
What is the SMILES notation for dicyanocyanamide?
The canonical SMILES for dicyanocyanamide is N#CN(C#N)C#N.
What is the InChIKey of dicyanocyanamide?
The InChIKey is ZXNYKOAICSPUKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C3N4/c4-1-7(2-5)3-6.
What are the key properties of dicyanocyanamide?
dicyanocyanamide has a molecular weight of 92.06 g/mol, XLogP of -0.27, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dicyanocyanamide is sourced from PubChem (CID 14849309), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).