About 4-(2-methoxyethyl)-1,5-dimethyl-1,2,4-triazol-4-ium-3-thiolate
4-(2-methoxyethyl)-1,5-dimethyl-1,2,4-triazol-4-ium-3-thiolate (PubChem CID 14849503) has the molecular formula C7H13N3OS
and a molecular weight of 187.27 g/mol. Its IUPAC name is 4-(2-methoxyethyl)-1,5-dimethyl-1,2,4-triazol-4-ium-3-thiolate.
Molecular Properties
| Compound Name | 4-(2-methoxyethyl)-1,5-dimethyl-1,2,4-triazol-4-ium-3-thiolate |
| PubChem CID | 14849503 |
| Molecular Formula | C7H13N3OS |
| Molecular Weight | 187.27 g/mol |
| Exact Mass | 187.08 |
| IUPAC Name | 4-(2-methoxyethyl)-1,5-dimethyl-1,2,4-triazol-4-ium-3-thiolate |
| SMILES | COCC[n+]1c([S-])nn(C)c1C |
| InChI | InChI=1S/C7H13N3OS/c1-6-9(2)8-7(12)10(6)4-5-11-3/h4-5H2,1-3H3 |
| InChIKey | GRKLCHWPRVODTN-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.27 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze 4-(2-methoxyethyl)-1,5-dimethyl-1,2,4-triazol-4-ium-3-thiolate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-methoxyethyl)-1,5-dimethyl-1,2,4-triazol-4-ium-3-thiolate?
The IUPAC name of 4-(2-methoxyethyl)-1,5-dimethyl-1,2,4-triazol-4-ium-3-thiolate (CID 14849503) is 4-(2-methoxyethyl)-1,5-dimethyl-1,2,4-triazol-4-ium-3-thiolate.
What is the SMILES notation for 4-(2-methoxyethyl)-1,5-dimethyl-1,2,4-triazol-4-ium-3-thiolate?
The canonical SMILES for 4-(2-methoxyethyl)-1,5-dimethyl-1,2,4-triazol-4-ium-3-thiolate is COCC[n+]1c([S-])nn(C)c1C.
What is the InChIKey of 4-(2-methoxyethyl)-1,5-dimethyl-1,2,4-triazol-4-ium-3-thiolate?
The InChIKey is GRKLCHWPRVODTN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13N3OS/c1-6-9(2)8-7(12)10(6)4-5-11-3/h4-5H2,1-3H3.
What are the key properties of 4-(2-methoxyethyl)-1,5-dimethyl-1,2,4-triazol-4-ium-3-thiolate?
4-(2-methoxyethyl)-1,5-dimethyl-1,2,4-triazol-4-ium-3-thiolate has a molecular weight of 187.27 g/mol, XLogP of -0.43, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-methoxyethyl)-1,5-dimethyl-1,2,4-triazol-4-ium-3-thiolate is sourced from PubChem (CID 14849503), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).