About 4-butyl-2,3-dimethyl-1H-1,2,4-triazol-4-ium-5-thione
4-butyl-2,3-dimethyl-1H-1,2,4-triazol-4-ium-5-thione (PubChem CID 14849506) has the molecular formula C8H16N3S+
and a molecular weight of 186.30 g/mol. Its IUPAC name is 4-butyl-2,3-dimethyl-1H-1,2,4-triazol-4-ium-5-thione.
Molecular Properties
| Compound Name | 4-butyl-2,3-dimethyl-1H-1,2,4-triazol-4-ium-5-thione |
| PubChem CID | 14849506 |
| Molecular Formula | C8H16N3S+ |
| Molecular Weight | 186.30 g/mol |
| Exact Mass | 186.11 |
| IUPAC Name | 4-butyl-2,3-dimethyl-1H-1,2,4-triazol-4-ium-5-thione |
| SMILES | CCCC[n+]1c(C)n(C)[nH]c1=S |
| InChI | InChI=1S/C8H15N3S/c1-4-5-6-11-7(2)10(3)9-8(11)12/h4-6H2,1-3H3/p+1 |
| InChIKey | CNZBCDVTQWWVLY-UHFFFAOYSA-O |
| XLogP | 1.48 |
| TPSA | 24.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.30 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 4-butyl-2,3-dimethyl-1H-1,2,4-triazol-4-ium-5-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-butyl-2,3-dimethyl-1H-1,2,4-triazol-4-ium-5-thione?
The IUPAC name of 4-butyl-2,3-dimethyl-1H-1,2,4-triazol-4-ium-5-thione (CID 14849506) is 4-butyl-2,3-dimethyl-1H-1,2,4-triazol-4-ium-5-thione.
What is the SMILES notation for 4-butyl-2,3-dimethyl-1H-1,2,4-triazol-4-ium-5-thione?
The canonical SMILES for 4-butyl-2,3-dimethyl-1H-1,2,4-triazol-4-ium-5-thione is CCCC[n+]1c(C)n(C)[nH]c1=S.
What is the InChIKey of 4-butyl-2,3-dimethyl-1H-1,2,4-triazol-4-ium-5-thione?
The InChIKey is CNZBCDVTQWWVLY-UHFFFAOYSA-O. The full InChI is InChI=1S/C8H15N3S/c1-4-5-6-11-7(2)10(3)9-8(11)12/h4-6H2,1-3H3/p+1.
What are the key properties of 4-butyl-2,3-dimethyl-1H-1,2,4-triazol-4-ium-5-thione?
4-butyl-2,3-dimethyl-1H-1,2,4-triazol-4-ium-5-thione has a molecular weight of 186.30 g/mol, XLogP of 1.48, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-butyl-2,3-dimethyl-1H-1,2,4-triazol-4-ium-5-thione is sourced from PubChem (CID 14849506), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).