About 1-ethyl-3-(1,2,4-triazol-4-yl)thiourea
1-ethyl-3-(1,2,4-triazol-4-yl)thiourea (PubChem CID 1485045) has the molecular formula C5H9N5S
and a molecular weight of 171.23 g/mol. Its IUPAC name is 1-ethyl-3-(1,2,4-triazol-4-yl)thiourea.
Molecular Properties
| Compound Name | 1-ethyl-3-(1,2,4-triazol-4-yl)thiourea |
| PubChem CID | 1485045 |
| Molecular Formula | C5H9N5S |
| Molecular Weight | 171.23 g/mol |
| Exact Mass | 171.06 |
| IUPAC Name | 1-ethyl-3-(1,2,4-triazol-4-yl)thiourea |
| SMILES | CCNC(=S)Nn1cnnc1 |
| InChI | InChI=1S/C5H9N5S/c1-2-6-5(11)9-10-3-7-8-4-10/h3-4H,2H2,1H3,(H2,6,9,11) |
| InChIKey | KIKXOOGOLARHIO-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 54.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.23 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-ethyl-3-(1,2,4-triazol-4-yl)thiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-3-(1,2,4-triazol-4-yl)thiourea?
The IUPAC name of 1-ethyl-3-(1,2,4-triazol-4-yl)thiourea (CID 1485045) is 1-ethyl-3-(1,2,4-triazol-4-yl)thiourea.
What is the SMILES notation for 1-ethyl-3-(1,2,4-triazol-4-yl)thiourea?
The canonical SMILES for 1-ethyl-3-(1,2,4-triazol-4-yl)thiourea is CCNC(=S)Nn1cnnc1.
What is the InChIKey of 1-ethyl-3-(1,2,4-triazol-4-yl)thiourea?
The InChIKey is KIKXOOGOLARHIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9N5S/c1-2-6-5(11)9-10-3-7-8-4-10/h3-4H,2H2,1H3,(H2,6,9,11).
What are the key properties of 1-ethyl-3-(1,2,4-triazol-4-yl)thiourea?
1-ethyl-3-(1,2,4-triazol-4-yl)thiourea has a molecular weight of 171.23 g/mol, XLogP of -0.28, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-3-(1,2,4-triazol-4-yl)thiourea is sourced from PubChem (CID 1485045), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).