C21H19FN2O4 — CID 148505547
5-[(4-fluorophenyl)methyl]-3,6-diimino-2-methyl-4,7-dioxo-7-phenylheptanoic acid (PubChem CID 148505547) has the molecular formula C21H19FN2O4 and a molecular weight of 382.39 g/mol. Its IUPAC name is 5-[(4-fluorophenyl)methyl]-3,6-diimino-2-methyl-4,7-dioxo-7-phenylheptanoic acid.
| Compound Name | 5-[(4-fluorophenyl)methyl]-3,6-diimino-2-methyl-4,7-dioxo-7-phenylheptanoic acid |
|---|---|
| PubChem CID | 148505547 |
| Molecular Formula | C21H19FN2O4 |
| Molecular Weight | 382.39 g/mol |
| Exact Mass | 382.13 |
| IUPAC Name | 5-[(4-fluorophenyl)methyl]-3,6-diimino-2-methyl-4,7-dioxo-7-phenylheptanoic acid |
| SMILES | [H]/N=C(\C(=O)c1ccccc1)C(Cc1ccc(F)cc1)C(=O)/C(=N/[H])C(C)C(=O)O |
| InChI | InChI=1S/C21H19FN2O4/c1-12(21(27)28)17(23)20(26)16(11-13-7-9-15(22)10-8-13)18(24)19(25)14-5-3-2-4-6-14/h2-10,12,16,23-24H,11H2,1H3,(H,27,28)/b23-17+,24-18- |
| InChIKey | MLMRHEJYXSMJOV-QEYUTVSCSA-N |
| XLogP | 3.20 |
| TPSA | 119.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.39 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|