C26H39ClO10 — CID 148507616
(2R,3S,4R,5S,6R)-2-[2-[4-chloro-6-[2-[(2R,3S,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]ethynyl]cyclodecyl]ethynyl]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 148507616) has the molecular formula C26H39ClO10 and a molecular weight of 547.04 g/mol. Its IUPAC name is (2R,3S,4R,5S,6R)-2-[2-[4-chloro-6-[2-[(2R,3S,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]ethynyl]cyclodecyl]ethynyl]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2R,3S,4R,5S,6R)-2-[2-[4-chloro-6-[2-[(2R,3S,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]ethynyl]cyclodecyl]ethynyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 148507616 |
| Molecular Formula | C26H39ClO10 |
| Molecular Weight | 547.04 g/mol |
| Exact Mass | 546.22 |
| IUPAC Name | (2R,3S,4R,5S,6R)-2-[2-[4-chloro-6-[2-[(2R,3S,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]ethynyl]cyclodecyl]ethynyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | OC[C@H]1O[C@H](C#CC2CCCCC(C#C[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]3O)CC(Cl)CC2)[C@@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C26H39ClO10/c27-16-8-5-14(6-9-17-21(30)25(34)23(32)19(12-28)36-17)3-1-2-4-15(11-16)7-10-18-22(31)26(35)24(33)20(13-29)37-18/h14-26,28-35H,1-5,8,11-13H2/t14?,15?,16?,17-,18-,19-,20-,21-,22-,23-,24-,25-,26-/m1/s1 |
| InChIKey | MLWJSLGGTKWDTB-GMYQDZDDSA-N |
| XLogP | -1.74 |
| TPSA | 180.30 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.04 |
| LogP ≤ 5 | -1.74 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|