About N'-(2-amino-1,2-dicyanoethenyl)-2-iminopropanimidamide
N'-(2-amino-1,2-dicyanoethenyl)-2-iminopropanimidamide (PubChem CID 148508577) has the molecular formula C7H8N6
and a molecular weight of 176.18 g/mol. Its IUPAC name is N'-(2-amino-1,2-dicyanoethenyl)-2-iminopropanimidamide.
Molecular Properties
| Compound Name | N'-(2-amino-1,2-dicyanoethenyl)-2-iminopropanimidamide |
| PubChem CID | 148508577 |
| Molecular Formula | C7H8N6 |
| Molecular Weight | 176.18 g/mol |
| Exact Mass | 176.08 |
| IUPAC Name | N'-(2-amino-1,2-dicyanoethenyl)-2-iminopropanimidamide |
| SMILES | [H]/N=C(C)/C(N)=N/C(C#N)=C(N)C#N |
| InChI | InChI=1S/C7H8N6/c1-4(10)7(12)13-6(3-9)5(11)2-8/h10H,11H2,1H3,(H2,12,13)/b6-5?,10-4+ |
| InChIKey | XHLQGGFISGWSCQ-QPXSKLCYSA-N |
| XLogP | -0.40 |
| TPSA | 135.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.18 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N'-(2-amino-1,2-dicyanoethenyl)-2-iminopropanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(2-amino-1,2-dicyanoethenyl)-2-iminopropanimidamide?
The IUPAC name of N'-(2-amino-1,2-dicyanoethenyl)-2-iminopropanimidamide (CID 148508577) is N'-(2-amino-1,2-dicyanoethenyl)-2-iminopropanimidamide.
What is the SMILES notation for N'-(2-amino-1,2-dicyanoethenyl)-2-iminopropanimidamide?
The canonical SMILES for N'-(2-amino-1,2-dicyanoethenyl)-2-iminopropanimidamide is [H]/N=C(C)/C(N)=N/C(C#N)=C(N)C#N.
What is the InChIKey of N'-(2-amino-1,2-dicyanoethenyl)-2-iminopropanimidamide?
The InChIKey is XHLQGGFISGWSCQ-QPXSKLCYSA-N. The full InChI is InChI=1S/C7H8N6/c1-4(10)7(12)13-6(3-9)5(11)2-8/h10H,11H2,1H3,(H2,12,13)/b6-5?,10-4+.
What are the key properties of N'-(2-amino-1,2-dicyanoethenyl)-2-iminopropanimidamide?
N'-(2-amino-1,2-dicyanoethenyl)-2-iminopropanimidamide has a molecular weight of 176.18 g/mol, XLogP of -0.40, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(2-amino-1,2-dicyanoethenyl)-2-iminopropanimidamide is sourced from PubChem (CID 148508577), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).