About 3-[(2-iodo-1,3-dihydroisoindol-5-yl)oxy]propan-1-amine
3-[(2-iodo-1,3-dihydroisoindol-5-yl)oxy]propan-1-amine (PubChem CID 148510834) has the molecular formula C11H15IN2O
and a molecular weight of 318.16 g/mol. Its IUPAC name is 3-[(2-iodo-1,3-dihydroisoindol-5-yl)oxy]propan-1-amine.
Molecular Properties
| Compound Name | 3-[(2-iodo-1,3-dihydroisoindol-5-yl)oxy]propan-1-amine |
| PubChem CID | 148510834 |
| Molecular Formula | C11H15IN2O |
| Molecular Weight | 318.16 g/mol |
| Exact Mass | 318.02 |
| IUPAC Name | 3-[(2-iodo-1,3-dihydroisoindol-5-yl)oxy]propan-1-amine |
| SMILES | NCCCOc1ccc2c(c1)CN(I)C2 |
| InChI | InChI=1S/C11H15IN2O/c12-14-7-9-2-3-11(6-10(9)8-14)15-5-1-4-13/h2-3,6H,1,4-5,7-8,13H2 |
| InChIKey | MMMBKNDQMGKFSW-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.16 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze 3-[(2-iodo-1,3-dihydroisoindol-5-yl)oxy]propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2-iodo-1,3-dihydroisoindol-5-yl)oxy]propan-1-amine?
The IUPAC name of 3-[(2-iodo-1,3-dihydroisoindol-5-yl)oxy]propan-1-amine (CID 148510834) is 3-[(2-iodo-1,3-dihydroisoindol-5-yl)oxy]propan-1-amine.
What is the SMILES notation for 3-[(2-iodo-1,3-dihydroisoindol-5-yl)oxy]propan-1-amine?
The canonical SMILES for 3-[(2-iodo-1,3-dihydroisoindol-5-yl)oxy]propan-1-amine is NCCCOc1ccc2c(c1)CN(I)C2.
What is the InChIKey of 3-[(2-iodo-1,3-dihydroisoindol-5-yl)oxy]propan-1-amine?
The InChIKey is MMMBKNDQMGKFSW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15IN2O/c12-14-7-9-2-3-11(6-10(9)8-14)15-5-1-4-13/h2-3,6H,1,4-5,7-8,13H2.
What are the key properties of 3-[(2-iodo-1,3-dihydroisoindol-5-yl)oxy]propan-1-amine?
3-[(2-iodo-1,3-dihydroisoindol-5-yl)oxy]propan-1-amine has a molecular weight of 318.16 g/mol, XLogP of 2.08, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2-iodo-1,3-dihydroisoindol-5-yl)oxy]propan-1-amine is sourced from PubChem (CID 148510834), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).