About 1-[(3,4-dichlorophenyl)methyl]-N'-(thiophene-2-carbonyl)piperidine-4-carbohydrazide
1-[(3,4-dichlorophenyl)methyl]-N'-(thiophene-2-carbonyl)piperidine-4-carbohydrazide (PubChem CID 1485117) has the molecular formula C18H19Cl2N3O2S
and a molecular weight of 412.34 g/mol. Its IUPAC name is 1-[(3,4-dichlorophenyl)methyl]-N'-(thiophene-2-carbonyl)piperidine-4-carbohydrazide.
Molecular Properties
| Compound Name | 1-[(3,4-dichlorophenyl)methyl]-N'-(thiophene-2-carbonyl)piperidine-4-carbohydrazide |
| PubChem CID | 1485117 |
| Molecular Formula | C18H19Cl2N3O2S |
| Molecular Weight | 412.34 g/mol |
| Exact Mass | 411.06 |
| IUPAC Name | 1-[(3,4-dichlorophenyl)methyl]-N'-(thiophene-2-carbonyl)piperidine-4-carbohydrazide |
| SMILES | O=C(NNC(=O)C1CCN(Cc2ccc(Cl)c(Cl)c2)CC1)c1cccs1 |
| InChI | InChI=1S/C18H19Cl2N3O2S/c19-14-4-3-12(10-15(14)20)11-23-7-5-13(6-8-23)17(24)21-22-18(25)16-2-1-9-26-16/h1-4,9-10,13H,5-8,11H2,(H,21,24)(H,22,25) |
| InChIKey | NOAGMHASBSNGEH-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 412.34 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-[(3,4-dichlorophenyl)methyl]-N'-(thiophene-2-carbonyl)piperidine-4-carbohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3,4-dichlorophenyl)methyl]-N'-(thiophene-2-carbonyl)piperidine-4-carbohydrazide?
The IUPAC name of 1-[(3,4-dichlorophenyl)methyl]-N'-(thiophene-2-carbonyl)piperidine-4-carbohydrazide (CID 1485117) is 1-[(3,4-dichlorophenyl)methyl]-N'-(thiophene-2-carbonyl)piperidine-4-carbohydrazide.
What is the SMILES notation for 1-[(3,4-dichlorophenyl)methyl]-N'-(thiophene-2-carbonyl)piperidine-4-carbohydrazide?
The canonical SMILES for 1-[(3,4-dichlorophenyl)methyl]-N'-(thiophene-2-carbonyl)piperidine-4-carbohydrazide is O=C(NNC(=O)C1CCN(Cc2ccc(Cl)c(Cl)c2)CC1)c1cccs1.
What is the InChIKey of 1-[(3,4-dichlorophenyl)methyl]-N'-(thiophene-2-carbonyl)piperidine-4-carbohydrazide?
The InChIKey is NOAGMHASBSNGEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19Cl2N3O2S/c19-14-4-3-12(10-15(14)20)11-23-7-5-13(6-8-23)17(24)21-22-18(25)16-2-1-9-26-16/h1-4,9-10,13H,5-8,11H2,(H,21,24)(H,22,25).
What are the key properties of 1-[(3,4-dichlorophenyl)methyl]-N'-(thiophene-2-carbonyl)piperidine-4-carbohydrazide?
1-[(3,4-dichlorophenyl)methyl]-N'-(thiophene-2-carbonyl)piperidine-4-carbohydrazide has a molecular weight of 412.34 g/mol, XLogP of 3.73, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3,4-dichlorophenyl)methyl]-N'-(thiophene-2-carbonyl)piperidine-4-carbohydrazide is sourced from PubChem (CID 1485117), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).