C18H32O2Si — CID 14851423
(2E,4E)-5-[(1R,2R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclohexyl]penta-2,4-dienal (PubChem CID 14851423) has the molecular formula C18H32O2Si and a molecular weight of 308.54 g/mol. Its IUPAC name is (2E,4E)-5-[(1R,2R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclohexyl]penta-2,4-dienal.
| Compound Name | (2E,4E)-5-[(1R,2R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclohexyl]penta-2,4-dienal |
|---|---|
| PubChem CID | 14851423 |
| Molecular Formula | C18H32O2Si |
| Molecular Weight | 308.54 g/mol |
| Exact Mass | 308.22 |
| IUPAC Name | (2E,4E)-5-[(1R,2R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclohexyl]penta-2,4-dienal |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@@H]1CCCC[C@@H]1/C=C/C=C/C=O |
| InChI | InChI=1S/C18H32O2Si/c1-18(2,3)21(4,5)20-15-17-13-9-8-12-16(17)11-7-6-10-14-19/h6-7,10-11,14,16-17H,8-9,12-13,15H2,1-5H3/b10-6+,11-7+/t16-,17-/m0/s1 |
| InChIKey | STGAKPBYVSXMIN-XELROBEESA-N |
| XLogP | 5.13 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.54 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|