C29H30ClFN4O5 — CID 148514299
(E)-5-[(4aR,7aS)-2,3,4a,5,7,7a-hexahydro-[1,4]dioxino[2,3-c]pyrrol-6-yl]-1-[4-(3-chloro-4-fluoroanilino)-7-[(3S)-oxolan-3-yl]oxyquinazolin-6-yl]pent-3-en-2-one (PubChem CID 148514299) has the molecular formula C29H30ClFN4O5 and a molecular weight of 569.03 g/mol. Its IUPAC name is (E)-5-[(4aR,7aS)-2,3,4a,5,7,7a-hexahydro-[1,4]dioxino[2,3-c]pyrrol-6-yl]-1-[4-(3-chloro-4-fluoroanilino)-7-[(3S)-oxolan-3-yl]oxyquinazolin-6-yl]pent-3-en-2-one.
| Compound Name | (E)-5-[(4aR,7aS)-2,3,4a,5,7,7a-hexahydro-[1,4]dioxino[2,3-c]pyrrol-6-yl]-1-[4-(3-chloro-4-fluoroanilino)-7-[(3S)-oxolan-3-yl]oxyquinazolin-6-yl]pent-3-en-2-one |
|---|---|
| PubChem CID | 148514299 |
| Molecular Formula | C29H30ClFN4O5 |
| Molecular Weight | 569.03 g/mol |
| Exact Mass | 568.19 |
| IUPAC Name | (E)-5-[(4aR,7aS)-2,3,4a,5,7,7a-hexahydro-[1,4]dioxino[2,3-c]pyrrol-6-yl]-1-[4-(3-chloro-4-fluoroanilino)-7-[(3S)-oxolan-3-yl]oxyquinazolin-6-yl]pent-3-en-2-one |
| SMILES | O=C(/C=C/CN1C[C@@H]2OCCO[C@@H]2C1)Cc1cc2c(Nc3ccc(F)c(Cl)c3)ncnc2cc1O[C@H]1CCOC1 |
| InChI | InChI=1S/C29H30ClFN4O5/c30-23-12-19(3-4-24(23)31)34-29-22-11-18(26(13-25(22)32-17-33-29)40-21-5-7-37-16-21)10-20(36)2-1-6-35-14-27-28(15-35)39-9-8-38-27/h1-4,11-13,17,21,27-28H,5-10,14-16H2,(H,32,33,34)/b2-1+/t21-,27-,28+/m0/s1 |
| InChIKey | MNDBDRKKUKSDFQ-CNMZYKQDSA-N |
| XLogP | 4.10 |
| TPSA | 95.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.03 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|