C12H21F3N2O2 — CID 148515664
1,1,1-trifluoropropan-2-yl 4-tert-butyl-2,2,3,3,5,6-hexadeuteriopiperazine-1-carboxylate (PubChem CID 148515664) has the molecular formula C12H21F3N2O2 and a molecular weight of 288.34 g/mol. Its IUPAC name is 1,1,1-trifluoropropan-2-yl 4-tert-butyl-2,2,3,3,5,6-hexadeuteriopiperazine-1-carboxylate.
| Compound Name | 1,1,1-trifluoropropan-2-yl 4-tert-butyl-2,2,3,3,5,6-hexadeuteriopiperazine-1-carboxylate |
|---|---|
| PubChem CID | 148515664 |
| Molecular Formula | C12H21F3N2O2 |
| Molecular Weight | 288.34 g/mol |
| Exact Mass | 288.19 |
| IUPAC Name | 1,1,1-trifluoropropan-2-yl 4-tert-butyl-2,2,3,3,5,6-hexadeuteriopiperazine-1-carboxylate |
| SMILES | [2H]C1C([2H])N(C(C)(C)C)C([2H])([2H])C([2H])([2H])N1C(=O)OC(C)C(F)(F)F |
| InChI | InChI=1S/C12H21F3N2O2/c1-9(12(13,14)15)19-10(18)16-5-7-17(8-6-16)11(2,3)4/h9H,5-8H2,1-4H3/i5D,6D2,7D,8D2 |
| InChIKey | MNJNJZQHMUBFLV-WUCDNPGUSA-N |
| XLogP | 2.49 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.34 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |