C25H17ClN6S — CID 14851862
4-[3-(benzimidazol-1-yl)prop-1-ynyl]-7-(2-chlorophenyl)-13-methyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaene (PubChem CID 14851862) has the molecular formula C25H17ClN6S and a molecular weight of 468.97 g/mol. Its IUPAC name is 4-[3-(benzimidazol-1-yl)prop-1-ynyl]-7-(2-chlorophenyl)-13-methyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaene.
| Compound Name | 4-[3-(benzimidazol-1-yl)prop-1-ynyl]-7-(2-chlorophenyl)-13-methyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaene |
|---|---|
| PubChem CID | 14851862 |
| Molecular Formula | C25H17ClN6S |
| Molecular Weight | 468.97 g/mol |
| Exact Mass | 468.09 |
| IUPAC Name | 4-[3-(benzimidazol-1-yl)prop-1-ynyl]-7-(2-chlorophenyl)-13-methyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaene |
| SMILES | Cc1nnc2n1-c1sc(C#CCn3cnc4ccccc43)cc1C(c1ccccc1Cl)=NC2 |
| InChI | InChI=1S/C25H17ClN6S/c1-16-29-30-23-14-27-24(18-8-2-3-9-20(18)26)19-13-17(33-25(19)32(16)23)7-6-12-31-15-28-21-10-4-5-11-22(21)31/h2-5,8-11,13,15H,12,14H2,1H3 |
| InChIKey | OZRSDKXTXHALOY-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 60.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.97 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|