C27H19ClN6O2S — CID 14851882
1-[3-[7-(2-chlorophenyl)-13-methyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-4-yl]prop-2-ynyl]-3-methylquinazoline-2,4-dione (PubChem CID 14851882) has the molecular formula C27H19ClN6O2S and a molecular weight of 527.01 g/mol. Its IUPAC name is 1-[3-[7-(2-chlorophenyl)-13-methyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-4-yl]prop-2-ynyl]-3-methylquinazoline-2,4-dione.
| Compound Name | 1-[3-[7-(2-chlorophenyl)-13-methyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-4-yl]prop-2-ynyl]-3-methylquinazoline-2,4-dione |
|---|---|
| PubChem CID | 14851882 |
| Molecular Formula | C27H19ClN6O2S |
| Molecular Weight | 527.01 g/mol |
| Exact Mass | 526.10 |
| IUPAC Name | 1-[3-[7-(2-chlorophenyl)-13-methyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-4-yl]prop-2-ynyl]-3-methylquinazoline-2,4-dione |
| SMILES | Cc1nnc2n1-c1sc(C#CCn3c(=O)n(C)c(=O)c4ccccc43)cc1C(c1ccccc1Cl)=NC2 |
| InChI | InChI=1S/C27H19ClN6O2S/c1-16-30-31-23-15-29-24(18-9-3-5-11-21(18)28)20-14-17(37-26(20)34(16)23)8-7-13-33-22-12-6-4-10-19(22)25(35)32(2)27(33)36/h3-6,9-12,14H,13,15H2,1-2H3 |
| InChIKey | RNSNEJVQHZFMQU-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 87.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.01 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|