C20H19ClN4SSi — CID 14851899
2-[7-(2-chlorophenyl)-13-methyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-4-yl]ethynyl-trimethylsilane (PubChem CID 14851899) has the molecular formula C20H19ClN4SSi and a molecular weight of 411.01 g/mol. Its IUPAC name is 2-[7-(2-chlorophenyl)-13-methyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-4-yl]ethynyl-trimethylsilane.
| Compound Name | 2-[7-(2-chlorophenyl)-13-methyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-4-yl]ethynyl-trimethylsilane |
|---|---|
| PubChem CID | 14851899 |
| Molecular Formula | C20H19ClN4SSi |
| Molecular Weight | 411.01 g/mol |
| Exact Mass | 410.08 |
| IUPAC Name | 2-[7-(2-chlorophenyl)-13-methyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-4-yl]ethynyl-trimethylsilane |
| SMILES | Cc1nnc2n1-c1sc(C#C[Si](C)(C)C)cc1C(c1ccccc1Cl)=NC2 |
| InChI | InChI=1S/C20H19ClN4SSi/c1-13-23-24-18-12-22-19(15-7-5-6-8-17(15)21)16-11-14(9-10-27(2,3)4)26-20(16)25(13)18/h5-8,11H,12H2,1-4H3 |
| InChIKey | ULVQLWDSHNVJNE-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 43.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.01 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|