C19H13FN4 — CID 14851900
8-ethynyl-6-(2-fluorophenyl)-1-methyl-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine (PubChem CID 14851900) has the molecular formula C19H13FN4 and a molecular weight of 316.34 g/mol. Its IUPAC name is 8-ethynyl-6-(2-fluorophenyl)-1-methyl-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine.
| Compound Name | 8-ethynyl-6-(2-fluorophenyl)-1-methyl-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine |
|---|---|
| PubChem CID | 14851900 |
| Molecular Formula | C19H13FN4 |
| Molecular Weight | 316.34 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | 8-ethynyl-6-(2-fluorophenyl)-1-methyl-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine |
| SMILES | C#Cc1ccc2c(c1)C(c1ccccc1F)=NCc1nnc(C)n1-2 |
| InChI | InChI=1S/C19H13FN4/c1-3-13-8-9-17-15(10-13)19(14-6-4-5-7-16(14)20)21-11-18-23-22-12(2)24(17)18/h1,4-10H,11H2,2H3 |
| InChIKey | GTOBFJHFOZIFFU-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 43.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.34 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|