C22H14ClN5S — CID 14851905
7-(2-chlorophenyl)-13-methyl-4-(2-pyridin-2-ylethynyl)-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaene (PubChem CID 14851905) has the molecular formula C22H14ClN5S and a molecular weight of 415.91 g/mol. Its IUPAC name is 7-(2-chlorophenyl)-13-methyl-4-(2-pyridin-2-ylethynyl)-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaene.
| Compound Name | 7-(2-chlorophenyl)-13-methyl-4-(2-pyridin-2-ylethynyl)-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaene |
|---|---|
| PubChem CID | 14851905 |
| Molecular Formula | C22H14ClN5S |
| Molecular Weight | 415.91 g/mol |
| Exact Mass | 415.07 |
| IUPAC Name | 7-(2-chlorophenyl)-13-methyl-4-(2-pyridin-2-ylethynyl)-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaene |
| SMILES | Cc1nnc2n1-c1sc(C#Cc3ccccn3)cc1C(c1ccccc1Cl)=NC2 |
| InChI | InChI=1S/C22H14ClN5S/c1-14-26-27-20-13-25-21(17-7-2-3-8-19(17)23)18-12-16(29-22(18)28(14)20)10-9-15-6-4-5-11-24-15/h2-8,11-12H,13H2,1H3 |
| InChIKey | NTXIFGGWEOLGTP-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 55.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.91 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|