C23H15ClN4S — CID 14851906
7-(2-chlorophenyl)-13-methyl-4-(2-phenylethynyl)-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaene (PubChem CID 14851906) has the molecular formula C23H15ClN4S and a molecular weight of 414.92 g/mol. Its IUPAC name is 7-(2-chlorophenyl)-13-methyl-4-(2-phenylethynyl)-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaene.
| Compound Name | 7-(2-chlorophenyl)-13-methyl-4-(2-phenylethynyl)-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaene |
|---|---|
| PubChem CID | 14851906 |
| Molecular Formula | C23H15ClN4S |
| Molecular Weight | 414.92 g/mol |
| Exact Mass | 414.07 |
| IUPAC Name | 7-(2-chlorophenyl)-13-methyl-4-(2-phenylethynyl)-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaene |
| SMILES | Cc1nnc2n1-c1sc(C#Cc3ccccc3)cc1C(c1ccccc1Cl)=NC2 |
| InChI | InChI=1S/C23H15ClN4S/c1-15-26-27-21-14-25-22(18-9-5-6-10-20(18)24)19-13-17(29-23(19)28(15)21)12-11-16-7-3-2-4-8-16/h2-10,13H,14H2,1H3 |
| InChIKey | UNQJUDRRVSTPAF-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 43.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.92 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|