C16H23ClO4 — CID 14852324
1-[(E)-4-chloro-3-methylbut-2-enyl]-2,3,4,5-tetramethoxy-6-methylbenzene (PubChem CID 14852324) has the molecular formula C16H23ClO4 and a molecular weight of 314.81 g/mol. Its IUPAC name is 1-[(E)-4-chloro-3-methylbut-2-enyl]-2,3,4,5-tetramethoxy-6-methylbenzene.
| Compound Name | 1-[(E)-4-chloro-3-methylbut-2-enyl]-2,3,4,5-tetramethoxy-6-methylbenzene |
|---|---|
| PubChem CID | 14852324 |
| Molecular Formula | C16H23ClO4 |
| Molecular Weight | 314.81 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | 1-[(E)-4-chloro-3-methylbut-2-enyl]-2,3,4,5-tetramethoxy-6-methylbenzene |
| SMILES | COc1c(C)c(C/C=C(\C)CCl)c(OC)c(OC)c1OC |
| InChI | InChI=1S/C16H23ClO4/c1-10(9-17)7-8-12-11(2)13(18-3)15(20-5)16(21-6)14(12)19-4/h7H,8-9H2,1-6H3/b10-7+ |
| InChIKey | HBWODJKZTQEUDZ-JXMROGBWSA-N |
| XLogP | 3.76 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.81 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|