C15H23NO4 — CID 14852342
2-[4-(dimethylamino)butyl]-5,6-dimethoxy-3-methylcyclohexa-2,5-diene-1,4-dione (PubChem CID 14852342) has the molecular formula C15H23NO4 and a molecular weight of 281.35 g/mol. Its IUPAC name is 2-[4-(dimethylamino)butyl]-5,6-dimethoxy-3-methylcyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2-[4-(dimethylamino)butyl]-5,6-dimethoxy-3-methylcyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 14852342 |
| Molecular Formula | C15H23NO4 |
| Molecular Weight | 281.35 g/mol |
| Exact Mass | 281.16 |
| IUPAC Name | 2-[4-(dimethylamino)butyl]-5,6-dimethoxy-3-methylcyclohexa-2,5-diene-1,4-dione |
| SMILES | COC1=C(OC)C(=O)C(CCCCN(C)C)=C(C)C1=O |
| InChI | InChI=1S/C15H23NO4/c1-10-11(8-6-7-9-16(2)3)13(18)15(20-5)14(19-4)12(10)17/h6-9H2,1-5H3 |
| InChIKey | GJAYZMBPHUXYPG-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.35 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|