C47H31N3S — CID 148524334
2-(4-benzo[b][1]benzothiepin-3-ylphenyl)-4,6-bis(4-phenylphenyl)-1,3,5-triazine (PubChem CID 148524334) has the molecular formula C47H31N3S and a molecular weight of 669.85 g/mol. Its IUPAC name is 2-(4-benzo[b][1]benzothiepin-3-ylphenyl)-4,6-bis(4-phenylphenyl)-1,3,5-triazine.
| Compound Name | 2-(4-benzo[b][1]benzothiepin-3-ylphenyl)-4,6-bis(4-phenylphenyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 148524334 |
| Molecular Formula | C47H31N3S |
| Molecular Weight | 669.85 g/mol |
| Exact Mass | 669.22 |
| IUPAC Name | 2-(4-benzo[b][1]benzothiepin-3-ylphenyl)-4,6-bis(4-phenylphenyl)-1,3,5-triazine |
| SMILES | C1=Cc2cc(-c3ccc(-c4nc(-c5ccc(-c6ccccc6)cc5)nc(-c5ccc(-c6ccccc6)cc5)n4)cc3)ccc2Sc2ccccc21 |
| InChI | InChI=1S/C47H31N3S/c1-3-9-32(10-4-1)34-15-22-38(23-16-34)45-48-46(39-24-17-35(18-25-39)33-11-5-2-6-12-33)50-47(49-45)40-26-19-36(20-27-40)41-29-30-44-42(31-41)28-21-37-13-7-8-14-43(37)51-44/h1-31H |
| InChIKey | MPANWMWHPKEEHH-UHFFFAOYSA-N |
| XLogP | 12.51 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.85 |
| LogP ≤ 5 | 12.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|