C26H25F3O5 — CID 14852499
4-[3-(1-adamantyl)-4-methoxybenzoyl]oxy-2-(trifluoromethyl)benzoic acid (PubChem CID 14852499) has the molecular formula C26H25F3O5 and a molecular weight of 474.48 g/mol. Its IUPAC name is 4-[3-(1-adamantyl)-4-methoxybenzoyl]oxy-2-(trifluoromethyl)benzoic acid.
| Compound Name | 4-[3-(1-adamantyl)-4-methoxybenzoyl]oxy-2-(trifluoromethyl)benzoic acid |
|---|---|
| PubChem CID | 14852499 |
| Molecular Formula | C26H25F3O5 |
| Molecular Weight | 474.48 g/mol |
| Exact Mass | 474.17 |
| IUPAC Name | 4-[3-(1-adamantyl)-4-methoxybenzoyl]oxy-2-(trifluoromethyl)benzoic acid |
| SMILES | COc1ccc(C(=O)Oc2ccc(C(=O)O)c(C(F)(F)F)c2)cc1C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C26H25F3O5/c1-33-22-5-2-17(9-21(22)25-11-14-6-15(12-25)8-16(7-14)13-25)24(32)34-18-3-4-19(23(30)31)20(10-18)26(27,28)29/h2-5,9-10,14-16H,6-8,11-13H2,1H3,(H,30,31) |
| InChIKey | OAKPXHTYJXYTFJ-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.48 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|