C22H38O4 — CID 14852592
methyl 4-[2-[(1E,3E)-tetradeca-1,3-dienyl]-1,3-dioxolan-4-yl]butanoate (PubChem CID 14852592) has the molecular formula C22H38O4 and a molecular weight of 366.54 g/mol. Its IUPAC name is methyl 4-[2-[(1E,3E)-tetradeca-1,3-dienyl]-1,3-dioxolan-4-yl]butanoate.
| Compound Name | methyl 4-[2-[(1E,3E)-tetradeca-1,3-dienyl]-1,3-dioxolan-4-yl]butanoate |
|---|---|
| PubChem CID | 14852592 |
| Molecular Formula | C22H38O4 |
| Molecular Weight | 366.54 g/mol |
| Exact Mass | 366.28 |
| IUPAC Name | methyl 4-[2-[(1E,3E)-tetradeca-1,3-dienyl]-1,3-dioxolan-4-yl]butanoate |
| SMILES | CCCCCCCCCC/C=C/C=C/C1OCC(CCCC(=O)OC)O1 |
| InChI | InChI=1S/C22H38O4/c1-3-4-5-6-7-8-9-10-11-12-13-14-18-22-25-19-20(26-22)16-15-17-21(23)24-2/h12-14,18,20,22H,3-11,15-17,19H2,1-2H3/b13-12+,18-14+ |
| InChIKey | SWKIOZKYIROMCB-MEAXDALNSA-N |
| XLogP | 5.71 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.54 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|