C19H32O4 — CID 14852605
methyl 4-[2-[(1E,3E)-undeca-1,3-dienyl]-1,3-dioxolan-4-yl]butanoate (PubChem CID 14852605) has the molecular formula C19H32O4 and a molecular weight of 324.46 g/mol. Its IUPAC name is methyl 4-[2-[(1E,3E)-undeca-1,3-dienyl]-1,3-dioxolan-4-yl]butanoate.
| Compound Name | methyl 4-[2-[(1E,3E)-undeca-1,3-dienyl]-1,3-dioxolan-4-yl]butanoate |
|---|---|
| PubChem CID | 14852605 |
| Molecular Formula | C19H32O4 |
| Molecular Weight | 324.46 g/mol |
| Exact Mass | 324.23 |
| IUPAC Name | methyl 4-[2-[(1E,3E)-undeca-1,3-dienyl]-1,3-dioxolan-4-yl]butanoate |
| SMILES | CCCCCCC/C=C/C=C/C1OCC(CCCC(=O)OC)O1 |
| InChI | InChI=1S/C19H32O4/c1-3-4-5-6-7-8-9-10-11-15-19-22-16-17(23-19)13-12-14-18(20)21-2/h9-11,15,17,19H,3-8,12-14,16H2,1-2H3/b10-9+,15-11+ |
| InChIKey | ZJQTXGVJSRKRJY-LVICEBGESA-N |
| XLogP | 4.54 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.46 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|