C18H30O4 — CID 14852607
4-[2-[(1E,3E)-undeca-1,3-dienyl]-1,3-dioxolan-4-yl]butanoic acid (PubChem CID 14852607) has the molecular formula C18H30O4 and a molecular weight of 310.43 g/mol. Its IUPAC name is 4-[2-[(1E,3E)-undeca-1,3-dienyl]-1,3-dioxolan-4-yl]butanoic acid.
| Compound Name | 4-[2-[(1E,3E)-undeca-1,3-dienyl]-1,3-dioxolan-4-yl]butanoic acid |
|---|---|
| PubChem CID | 14852607 |
| Molecular Formula | C18H30O4 |
| Molecular Weight | 310.43 g/mol |
| Exact Mass | 310.21 |
| IUPAC Name | 4-[2-[(1E,3E)-undeca-1,3-dienyl]-1,3-dioxolan-4-yl]butanoic acid |
| SMILES | CCCCCCC/C=C/C=C/C1OCC(CCCC(=O)O)O1 |
| InChI | InChI=1S/C18H30O4/c1-2-3-4-5-6-7-8-9-10-14-18-21-15-16(22-18)12-11-13-17(19)20/h8-10,14,16,18H,2-7,11-13,15H2,1H3,(H,19,20)/b9-8+,14-10+ |
| InChIKey | DNIBCJYVJCXAAP-ANVLWLQNSA-N |
| XLogP | 4.46 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.43 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|