C19H19F2NO2 — CID 14853248
4-(4-butoxyphenyl)-2-(2,6-difluorophenyl)-4,5-dihydro-1,3-oxazole (PubChem CID 14853248) has the molecular formula C19H19F2NO2 and a molecular weight of 331.36 g/mol. Its IUPAC name is 4-(4-butoxyphenyl)-2-(2,6-difluorophenyl)-4,5-dihydro-1,3-oxazole.
| Compound Name | 4-(4-butoxyphenyl)-2-(2,6-difluorophenyl)-4,5-dihydro-1,3-oxazole |
|---|---|
| PubChem CID | 14853248 |
| Molecular Formula | C19H19F2NO2 |
| Molecular Weight | 331.36 g/mol |
| Exact Mass | 331.14 |
| IUPAC Name | 4-(4-butoxyphenyl)-2-(2,6-difluorophenyl)-4,5-dihydro-1,3-oxazole |
| SMILES | CCCCOc1ccc(C2COC(c3c(F)cccc3F)=N2)cc1 |
| InChI | InChI=1S/C19H19F2NO2/c1-2-3-11-23-14-9-7-13(8-10-14)17-12-24-19(22-17)18-15(20)5-4-6-16(18)21/h4-10,17H,2-3,11-12H2,1H3 |
| InChIKey | XWBAIEJNFKLPBH-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.36 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|