About ethyl (Z)-2-(2-chloro-6,7-difluoroquinoline-3-carbonyl)-3-(dimethylamino)prop-2-enoate
ethyl (Z)-2-(2-chloro-6,7-difluoroquinoline-3-carbonyl)-3-(dimethylamino)prop-2-enoate (PubChem CID 14853338) has the molecular formula C17H15ClF2N2O3
and a molecular weight of 368.77 g/mol. Its IUPAC name is ethyl (Z)-2-(2-chloro-6,7-difluoroquinoline-3-carbonyl)-3-(dimethylamino)prop-2-enoate.
Molecular Properties
| Compound Name | ethyl (Z)-2-(2-chloro-6,7-difluoroquinoline-3-carbonyl)-3-(dimethylamino)prop-2-enoate |
| PubChem CID | 14853338 |
| Molecular Formula | C17H15ClF2N2O3 |
| Molecular Weight | 368.77 g/mol |
| Exact Mass | 368.07 |
| IUPAC Name | ethyl (Z)-2-(2-chloro-6,7-difluoroquinoline-3-carbonyl)-3-(dimethylamino)prop-2-enoate |
| SMILES | CCOC(=O)/C(=C\N(C)C)C(=O)c1cc2cc(F)c(F)cc2nc1Cl |
| InChI | InChI=1S/C17H15ClF2N2O3/c1-4-25-17(24)11(8-22(2)3)15(23)10-5-9-6-12(19)13(20)7-14(9)21-16(10)18/h5-8H,4H2,1-3H3/b11-8- |
| InChIKey | COMYBBUQYYTAQX-FLIBITNWSA-N |
| XLogP | 3.36 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.77 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|
Analyze ethyl (Z)-2-(2-chloro-6,7-difluoroquinoline-3-carbonyl)-3-(dimethylamino)prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (Z)-2-(2-chloro-6,7-difluoroquinoline-3-carbonyl)-3-(dimethylamino)prop-2-enoate?
The IUPAC name of ethyl (Z)-2-(2-chloro-6,7-difluoroquinoline-3-carbonyl)-3-(dimethylamino)prop-2-enoate (CID 14853338) is ethyl (Z)-2-(2-chloro-6,7-difluoroquinoline-3-carbonyl)-3-(dimethylamino)prop-2-enoate.
What is the SMILES notation for ethyl (Z)-2-(2-chloro-6,7-difluoroquinoline-3-carbonyl)-3-(dimethylamino)prop-2-enoate?
The canonical SMILES for ethyl (Z)-2-(2-chloro-6,7-difluoroquinoline-3-carbonyl)-3-(dimethylamino)prop-2-enoate is CCOC(=O)/C(=C\N(C)C)C(=O)c1cc2cc(F)c(F)cc2nc1Cl.
What is the InChIKey of ethyl (Z)-2-(2-chloro-6,7-difluoroquinoline-3-carbonyl)-3-(dimethylamino)prop-2-enoate?
The InChIKey is COMYBBUQYYTAQX-FLIBITNWSA-N. The full InChI is InChI=1S/C17H15ClF2N2O3/c1-4-25-17(24)11(8-22(2)3)15(23)10-5-9-6-12(19)13(20)7-14(9)21-16(10)18/h5-8H,4H2,1-3H3/b11-8-.
What are the key properties of ethyl (Z)-2-(2-chloro-6,7-difluoroquinoline-3-carbonyl)-3-(dimethylamino)prop-2-enoate?
ethyl (Z)-2-(2-chloro-6,7-difluoroquinoline-3-carbonyl)-3-(dimethylamino)prop-2-enoate has a molecular weight of 368.77 g/mol, XLogP of 3.36, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (Z)-2-(2-chloro-6,7-difluoroquinoline-3-carbonyl)-3-(dimethylamino)prop-2-enoate is sourced from PubChem (CID 14853338), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).