C30H42N4O6 — CID 148533581
N-[(3S)-1-[1-(5-ethyl-2-oxoheptyl)-2-oxo-3-pyridinyl]-9-methyl-2,6,7-trioxodecan-3-yl]-3-methylimidazole-4-carboxamide (PubChem CID 148533581) has the molecular formula C30H42N4O6 and a molecular weight of 554.69 g/mol. Its IUPAC name is N-[(3S)-1-[1-(5-ethyl-2-oxoheptyl)-2-oxo-3-pyridinyl]-9-methyl-2,6,7-trioxodecan-3-yl]-3-methylimidazole-4-carboxamide.
| Compound Name | N-[(3S)-1-[1-(5-ethyl-2-oxoheptyl)-2-oxo-3-pyridinyl]-9-methyl-2,6,7-trioxodecan-3-yl]-3-methylimidazole-4-carboxamide |
|---|---|
| PubChem CID | 148533581 |
| Molecular Formula | C30H42N4O6 |
| Molecular Weight | 554.69 g/mol |
| Exact Mass | 554.31 |
| IUPAC Name | N-[(3S)-1-[1-(5-ethyl-2-oxoheptyl)-2-oxo-3-pyridinyl]-9-methyl-2,6,7-trioxodecan-3-yl]-3-methylimidazole-4-carboxamide |
| SMILES | CCC(CC)CCC(=O)Cn1cccc(CC(=O)[C@H](CCC(=O)C(=O)CC(C)C)NC(=O)c2cncn2C)c1=O |
| InChI | InChI=1S/C30H42N4O6/c1-6-21(7-2)10-11-23(35)18-34-14-8-9-22(30(34)40)16-27(37)24(12-13-26(36)28(38)15-20(3)4)32-29(39)25-17-31-19-33(25)5/h8-9,14,17,19-21,24H,6-7,10-13,15-16,18H2,1-5H3,(H,32,39)/t24-/m0/s1 |
| InChIKey | MQTGGCCXWDUMRA-DEOSSOPVSA-N |
| XLogP | 3.24 |
| TPSA | 137.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.69 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|