C27H27F7N2O5S — CID 148534909
4-[[(2R)-2-[(5R)-5-fluoro-6-hydroxy-6-methyl-2-oxoheptyl]-6-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-3,4-dihydro-2H-quinolin-1-yl]sulfonyl]benzonitrile (PubChem CID 148534909) has the molecular formula C27H27F7N2O5S and a molecular weight of 624.58 g/mol. Its IUPAC name is 4-[[(2R)-2-[(5R)-5-fluoro-6-hydroxy-6-methyl-2-oxoheptyl]-6-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-3,4-dihydro-2H-quinolin-1-yl]sulfonyl]benzonitrile.
| Compound Name | 4-[[(2R)-2-[(5R)-5-fluoro-6-hydroxy-6-methyl-2-oxoheptyl]-6-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-3,4-dihydro-2H-quinolin-1-yl]sulfonyl]benzonitrile |
|---|---|
| PubChem CID | 148534909 |
| Molecular Formula | C27H27F7N2O5S |
| Molecular Weight | 624.58 g/mol |
| Exact Mass | 624.15 |
| IUPAC Name | 4-[[(2R)-2-[(5R)-5-fluoro-6-hydroxy-6-methyl-2-oxoheptyl]-6-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-3,4-dihydro-2H-quinolin-1-yl]sulfonyl]benzonitrile |
| SMILES | CC(C)(O)[C@H](F)CCC(=O)C[C@H]1CCc2cc(C(O)(C(F)(F)F)C(F)(F)F)ccc2N1S(=O)(=O)c1ccc(C#N)cc1 |
| InChI | InChI=1S/C27H27F7N2O5S/c1-24(2,38)23(28)12-8-20(37)14-19-7-5-17-13-18(25(39,26(29,30)31)27(32,33)34)6-11-22(17)36(19)42(40,41)21-9-3-16(15-35)4-10-21/h3-4,6,9-11,13,19,23,38-39H,5,7-8,12,14H2,1-2H3/t19-,23-/m1/s1 |
| InChIKey | MQZUTELVHJYHIU-AUSIDOKSSA-N |
| XLogP | 5.23 |
| TPSA | 118.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.58 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |