About ethyl 2-tritylsulfanylacetate
ethyl 2-tritylsulfanylacetate (PubChem CID 14853606) has the molecular formula C23H22O2S
and a molecular weight of 362.49 g/mol. Its IUPAC name is ethyl 2-tritylsulfanylacetate.
Molecular Properties
| Compound Name | ethyl 2-tritylsulfanylacetate |
| PubChem CID | 14853606 |
| Molecular Formula | C23H22O2S |
| Molecular Weight | 362.49 g/mol |
| Exact Mass | 362.13 |
| IUPAC Name | ethyl 2-tritylsulfanylacetate |
| SMILES | CCOC(=O)CSC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H22O2S/c1-2-25-22(24)18-26-23(19-12-6-3-7-13-19,20-14-8-4-9-15-20)21-16-10-5-11-17-21/h3-17H,2,18H2,1H3 |
| InChIKey | GWYLJEAGGOYYFB-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 362.49 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-tritylsulfanylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-tritylsulfanylacetate?
The IUPAC name of ethyl 2-tritylsulfanylacetate (CID 14853606) is ethyl 2-tritylsulfanylacetate.
What is the SMILES notation for ethyl 2-tritylsulfanylacetate?
The canonical SMILES for ethyl 2-tritylsulfanylacetate is CCOC(=O)CSC(c1ccccc1)(c1ccccc1)c1ccccc1.
What is the InChIKey of ethyl 2-tritylsulfanylacetate?
The InChIKey is GWYLJEAGGOYYFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H22O2S/c1-2-25-22(24)18-26-23(19-12-6-3-7-13-19,20-14-8-4-9-15-20)21-16-10-5-11-17-21/h3-17H,2,18H2,1H3.
What are the key properties of ethyl 2-tritylsulfanylacetate?
ethyl 2-tritylsulfanylacetate has a molecular weight of 362.49 g/mol, XLogP of 5.27, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-tritylsulfanylacetate is sourced from PubChem (CID 14853606), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).