About 4-cyclohexyl-1,2,5-trimethylimidazole
4-cyclohexyl-1,2,5-trimethylimidazole (PubChem CID 148536584) has the molecular formula C12H20N2
and a molecular weight of 192.31 g/mol. Its IUPAC name is 4-cyclohexyl-1,2,5-trimethylimidazole.
Molecular Properties
| Compound Name | 4-cyclohexyl-1,2,5-trimethylimidazole |
| PubChem CID | 148536584 |
| Molecular Formula | C12H20N2 |
| Molecular Weight | 192.31 g/mol |
| Exact Mass | 192.16 |
| IUPAC Name | 4-cyclohexyl-1,2,5-trimethylimidazole |
| SMILES | Cc1nc(C2CCCCC2)c(C)n1C |
| InChI | InChI=1S/C12H20N2/c1-9-12(13-10(2)14(9)3)11-7-5-4-6-8-11/h11H,4-8H2,1-3H3 |
| InChIKey | MRIMBTVZUDARSG-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.31 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-cyclohexyl-1,2,5-trimethylimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-cyclohexyl-1,2,5-trimethylimidazole?
The IUPAC name of 4-cyclohexyl-1,2,5-trimethylimidazole (CID 148536584) is 4-cyclohexyl-1,2,5-trimethylimidazole.
What is the SMILES notation for 4-cyclohexyl-1,2,5-trimethylimidazole?
The canonical SMILES for 4-cyclohexyl-1,2,5-trimethylimidazole is Cc1nc(C2CCCCC2)c(C)n1C.
What is the InChIKey of 4-cyclohexyl-1,2,5-trimethylimidazole?
The InChIKey is MRIMBTVZUDARSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20N2/c1-9-12(13-10(2)14(9)3)11-7-5-4-6-8-11/h11H,4-8H2,1-3H3.
What are the key properties of 4-cyclohexyl-1,2,5-trimethylimidazole?
4-cyclohexyl-1,2,5-trimethylimidazole has a molecular weight of 192.31 g/mol, XLogP of 3.08, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyclohexyl-1,2,5-trimethylimidazole is sourced from PubChem (CID 148536584), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).