About 1-chloro-2,3,5-triphenyltetrazole
1-chloro-2,3,5-triphenyltetrazole (PubChem CID 14854159) has the molecular formula C19H15ClN4
and a molecular weight of 334.81 g/mol. Its IUPAC name is 1-chloro-2,3,5-triphenyltetrazole.
Molecular Properties
| Compound Name | 1-chloro-2,3,5-triphenyltetrazole |
| PubChem CID | 14854159 |
| Molecular Formula | C19H15ClN4 |
| Molecular Weight | 334.81 g/mol |
| Exact Mass | 334.10 |
| IUPAC Name | 1-chloro-2,3,5-triphenyltetrazole |
| SMILES | ClN1C(c2ccccc2)=NN(c2ccccc2)N1c1ccccc1 |
| InChI | InChI=1S/C19H15ClN4/c20-22-19(16-10-4-1-5-11-16)21-23(17-12-6-2-7-13-17)24(22)18-14-8-3-9-15-18/h1-15H |
| InChIKey | RNRONMBFDNPPOJ-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 22.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.81 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze 1-chloro-2,3,5-triphenyltetrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-2,3,5-triphenyltetrazole?
The IUPAC name of 1-chloro-2,3,5-triphenyltetrazole (CID 14854159) is 1-chloro-2,3,5-triphenyltetrazole.
What is the SMILES notation for 1-chloro-2,3,5-triphenyltetrazole?
The canonical SMILES for 1-chloro-2,3,5-triphenyltetrazole is ClN1C(c2ccccc2)=NN(c2ccccc2)N1c1ccccc1.
What is the InChIKey of 1-chloro-2,3,5-triphenyltetrazole?
The InChIKey is RNRONMBFDNPPOJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H15ClN4/c20-22-19(16-10-4-1-5-11-16)21-23(17-12-6-2-7-13-17)24(22)18-14-8-3-9-15-18/h1-15H.
What are the key properties of 1-chloro-2,3,5-triphenyltetrazole?
1-chloro-2,3,5-triphenyltetrazole has a molecular weight of 334.81 g/mol, XLogP of 4.66, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-2,3,5-triphenyltetrazole is sourced from PubChem (CID 14854159), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).