C26H27N3O2 — CID 148546269
ethyl (E)-3-[3-cyano-1-(2,3-dihydro-1H-inden-1-yl)-4,6-diethylpyrrolo[2,3-b]pyridin-2-yl]prop-2-enoate (PubChem CID 148546269) has the molecular formula C26H27N3O2 and a molecular weight of 413.52 g/mol. Its IUPAC name is ethyl (E)-3-[3-cyano-1-(2,3-dihydro-1H-inden-1-yl)-4,6-diethylpyrrolo[2,3-b]pyridin-2-yl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[3-cyano-1-(2,3-dihydro-1H-inden-1-yl)-4,6-diethylpyrrolo[2,3-b]pyridin-2-yl]prop-2-enoate |
|---|---|
| PubChem CID | 148546269 |
| Molecular Formula | C26H27N3O2 |
| Molecular Weight | 413.52 g/mol |
| Exact Mass | 413.21 |
| IUPAC Name | ethyl (E)-3-[3-cyano-1-(2,3-dihydro-1H-inden-1-yl)-4,6-diethylpyrrolo[2,3-b]pyridin-2-yl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C/c1c(C#N)c2c(CC)cc(CC)nc2n1C1CCc2ccccc21 |
| InChI | InChI=1S/C26H27N3O2/c1-4-17-15-19(5-2)28-26-25(17)21(16-27)23(13-14-24(30)31-6-3)29(26)22-12-11-18-9-7-8-10-20(18)22/h7-10,13-15,22H,4-6,11-12H2,1-3H3/b14-13+ |
| InChIKey | KCJDUPGDKVBODQ-BUHFOSPRSA-N |
| XLogP | 5.14 |
| TPSA | 67.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.52 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|