C18H20N2O4 — CID 148547397
N,4,7-trimethyl-1,3-dioxo-N-phenyl-3a,5,6,7a-tetrahydro-4,7-epoxyisoindole-5-carboxamide (PubChem CID 148547397) has the molecular formula C18H20N2O4 and a molecular weight of 328.37 g/mol. Its IUPAC name is N,4,7-trimethyl-1,3-dioxo-N-phenyl-3a,5,6,7a-tetrahydro-4,7-epoxyisoindole-5-carboxamide.
| Compound Name | N,4,7-trimethyl-1,3-dioxo-N-phenyl-3a,5,6,7a-tetrahydro-4,7-epoxyisoindole-5-carboxamide |
|---|---|
| PubChem CID | 148547397 |
| Molecular Formula | C18H20N2O4 |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | N,4,7-trimethyl-1,3-dioxo-N-phenyl-3a,5,6,7a-tetrahydro-4,7-epoxyisoindole-5-carboxamide |
| SMILES | CN(C(=O)C1CC2(C)OC1(C)C1C(=O)NC(=O)C12)c1ccccc1 |
| InChI | InChI=1S/C18H20N2O4/c1-17-9-11(16(23)20(3)10-7-5-4-6-8-10)18(2,24-17)13-12(17)14(21)19-15(13)22/h4-8,11-13H,9H2,1-3H3,(H,19,21,22) |
| InChIKey | NRAZJJRYNAZJIK-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|