C18H24N2O3 — CID 148547675
1-[(2S)-2-amino-3-methylbutanoyl]-3-(3-phenylpropanoyl)pyrrolidin-2-one (PubChem CID 148547675) has the molecular formula C18H24N2O3 and a molecular weight of 316.40 g/mol. Its IUPAC name is 1-[(2S)-2-amino-3-methylbutanoyl]-3-(3-phenylpropanoyl)pyrrolidin-2-one.
| Compound Name | 1-[(2S)-2-amino-3-methylbutanoyl]-3-(3-phenylpropanoyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 148547675 |
| Molecular Formula | C18H24N2O3 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.18 |
| IUPAC Name | 1-[(2S)-2-amino-3-methylbutanoyl]-3-(3-phenylpropanoyl)pyrrolidin-2-one |
| SMILES | CC(C)[C@H](N)C(=O)N1CCC(C(=O)CCc2ccccc2)C1=O |
| InChI | InChI=1S/C18H24N2O3/c1-12(2)16(19)18(23)20-11-10-14(17(20)22)15(21)9-8-13-6-4-3-5-7-13/h3-7,12,14,16H,8-11,19H2,1-2H3/t14?,16-/m0/s1 |
| InChIKey | OLZWXHIACKKBKE-WMCAAGNKSA-N |
| XLogP | 1.55 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|