About 3-cyclobutyl-2,4-dihydropyrazolo[4,3-d]pyrimidin-5-one
3-cyclobutyl-2,4-dihydropyrazolo[4,3-d]pyrimidin-5-one (PubChem CID 148547846) has the molecular formula C9H10N4O
and a molecular weight of 190.21 g/mol. Its IUPAC name is 3-cyclobutyl-2,4-dihydropyrazolo[4,3-d]pyrimidin-5-one.
Molecular Properties
| Compound Name | 3-cyclobutyl-2,4-dihydropyrazolo[4,3-d]pyrimidin-5-one |
| PubChem CID | 148547846 |
| Molecular Formula | C9H10N4O |
| Molecular Weight | 190.21 g/mol |
| Exact Mass | 190.09 |
| IUPAC Name | 3-cyclobutyl-2,4-dihydropyrazolo[4,3-d]pyrimidin-5-one |
| SMILES | O=c1ncc2n[nH]c(C3CCC3)c2[nH]1 |
| InChI | InChI=1S/C9H10N4O/c14-9-10-4-6-8(11-9)7(13-12-6)5-2-1-3-5/h4-5H,1-3H2,(H,12,13)(H,10,11,14) |
| InChIKey | ZTNMCPWPCSTNMQ-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 74.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.21 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-cyclobutyl-2,4-dihydropyrazolo[4,3-d]pyrimidin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclobutyl-2,4-dihydropyrazolo[4,3-d]pyrimidin-5-one?
The IUPAC name of 3-cyclobutyl-2,4-dihydropyrazolo[4,3-d]pyrimidin-5-one (CID 148547846) is 3-cyclobutyl-2,4-dihydropyrazolo[4,3-d]pyrimidin-5-one.
What is the SMILES notation for 3-cyclobutyl-2,4-dihydropyrazolo[4,3-d]pyrimidin-5-one?
The canonical SMILES for 3-cyclobutyl-2,4-dihydropyrazolo[4,3-d]pyrimidin-5-one is O=c1ncc2n[nH]c(C3CCC3)c2[nH]1.
What is the InChIKey of 3-cyclobutyl-2,4-dihydropyrazolo[4,3-d]pyrimidin-5-one?
The InChIKey is ZTNMCPWPCSTNMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N4O/c14-9-10-4-6-8(11-9)7(13-12-6)5-2-1-3-5/h4-5H,1-3H2,(H,12,13)(H,10,11,14).
What are the key properties of 3-cyclobutyl-2,4-dihydropyrazolo[4,3-d]pyrimidin-5-one?
3-cyclobutyl-2,4-dihydropyrazolo[4,3-d]pyrimidin-5-one has a molecular weight of 190.21 g/mol, XLogP of 0.91, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclobutyl-2,4-dihydropyrazolo[4,3-d]pyrimidin-5-one is sourced from PubChem (CID 148547846), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).