About N-hydroxy-N-(1-methyl-3,4-dihydro-1H-isoquinolin-2-yl)methanimidamide
N-hydroxy-N-(1-methyl-3,4-dihydro-1H-isoquinolin-2-yl)methanimidamide (PubChem CID 148548233) has the molecular formula C11H15N3O
and a molecular weight of 205.26 g/mol. Its IUPAC name is N-hydroxy-N-(1-methyl-3,4-dihydro-1H-isoquinolin-2-yl)methanimidamide.
Molecular Properties
| Compound Name | N-hydroxy-N-(1-methyl-3,4-dihydro-1H-isoquinolin-2-yl)methanimidamide |
| PubChem CID | 148548233 |
| Molecular Formula | C11H15N3O |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.12 |
| IUPAC Name | N-hydroxy-N-(1-methyl-3,4-dihydro-1H-isoquinolin-2-yl)methanimidamide |
| SMILES | [H]/N=C/N(O)N1CCc2ccccc2C1C |
| InChI | InChI=1S/C11H15N3O/c1-9-11-5-3-2-4-10(11)6-7-13(9)14(15)8-12/h2-5,8-9,12,15H,6-7H2,1H3/b12-8+ |
| InChIKey | GEZJWQBBPNIQOI-XYOKQWHBSA-N |
| XLogP | 1.82 |
| TPSA | 50.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-hydroxy-N-(1-methyl-3,4-dihydro-1H-isoquinolin-2-yl)methanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-hydroxy-N-(1-methyl-3,4-dihydro-1H-isoquinolin-2-yl)methanimidamide?
The IUPAC name of N-hydroxy-N-(1-methyl-3,4-dihydro-1H-isoquinolin-2-yl)methanimidamide (CID 148548233) is N-hydroxy-N-(1-methyl-3,4-dihydro-1H-isoquinolin-2-yl)methanimidamide.
What is the SMILES notation for N-hydroxy-N-(1-methyl-3,4-dihydro-1H-isoquinolin-2-yl)methanimidamide?
The canonical SMILES for N-hydroxy-N-(1-methyl-3,4-dihydro-1H-isoquinolin-2-yl)methanimidamide is [H]/N=C/N(O)N1CCc2ccccc2C1C.
What is the InChIKey of N-hydroxy-N-(1-methyl-3,4-dihydro-1H-isoquinolin-2-yl)methanimidamide?
The InChIKey is GEZJWQBBPNIQOI-XYOKQWHBSA-N. The full InChI is InChI=1S/C11H15N3O/c1-9-11-5-3-2-4-10(11)6-7-13(9)14(15)8-12/h2-5,8-9,12,15H,6-7H2,1H3/b12-8+.
What are the key properties of N-hydroxy-N-(1-methyl-3,4-dihydro-1H-isoquinolin-2-yl)methanimidamide?
N-hydroxy-N-(1-methyl-3,4-dihydro-1H-isoquinolin-2-yl)methanimidamide has a molecular weight of 205.26 g/mol, XLogP of 1.82, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-hydroxy-N-(1-methyl-3,4-dihydro-1H-isoquinolin-2-yl)methanimidamide is sourced from PubChem (CID 148548233), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).