About 6,10-dihydro-4aH-indolo[1,2-b]indazole
6,10-dihydro-4aH-indolo[1,2-b]indazole (PubChem CID 148548376) has the molecular formula C14H12N2
and a molecular weight of 208.26 g/mol. Its IUPAC name is 6,10-dihydro-4aH-indolo[1,2-b]indazole.
Molecular Properties
| Compound Name | 6,10-dihydro-4aH-indolo[1,2-b]indazole |
| PubChem CID | 148548376 |
| Molecular Formula | C14H12N2 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.10 |
| IUPAC Name | 6,10-dihydro-4aH-indolo[1,2-b]indazole |
| SMILES | C1=CCC2=C3C=C4C=CC=CC4N3NC2=C1 |
| InChI | InChI=1S/C14H12N2/c1-4-8-13-10(5-1)9-14-11-6-2-3-7-12(11)15-16(13)14/h1-5,7-9,13,15H,6H2 |
| InChIKey | RHQUSRJJMBWMBW-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6,10-dihydro-4aH-indolo[1,2-b]indazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,10-dihydro-4aH-indolo[1,2-b]indazole?
The IUPAC name of 6,10-dihydro-4aH-indolo[1,2-b]indazole (CID 148548376) is 6,10-dihydro-4aH-indolo[1,2-b]indazole.
What is the SMILES notation for 6,10-dihydro-4aH-indolo[1,2-b]indazole?
The canonical SMILES for 6,10-dihydro-4aH-indolo[1,2-b]indazole is C1=CCC2=C3C=C4C=CC=CC4N3NC2=C1.
What is the InChIKey of 6,10-dihydro-4aH-indolo[1,2-b]indazole?
The InChIKey is RHQUSRJJMBWMBW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12N2/c1-4-8-13-10(5-1)9-14-11-6-2-3-7-12(11)15-16(13)14/h1-5,7-9,13,15H,6H2.
What are the key properties of 6,10-dihydro-4aH-indolo[1,2-b]indazole?
6,10-dihydro-4aH-indolo[1,2-b]indazole has a molecular weight of 208.26 g/mol, XLogP of 2.34, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6,10-dihydro-4aH-indolo[1,2-b]indazole is sourced from PubChem (CID 148548376), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).