About pyrazino[2,3-c]carbazol-2-one
pyrazino[2,3-c]carbazol-2-one (PubChem CID 148548388) has the molecular formula C14H7N3O
and a molecular weight of 233.23 g/mol. Its IUPAC name is pyrazino[2,3-c]carbazol-2-one.
Molecular Properties
| Compound Name | pyrazino[2,3-c]carbazol-2-one |
| PubChem CID | 148548388 |
| Molecular Formula | C14H7N3O |
| Molecular Weight | 233.23 g/mol |
| Exact Mass | 233.06 |
| IUPAC Name | pyrazino[2,3-c]carbazol-2-one |
| SMILES | O=C1C=Nc2ccc3c(c2=N1)=c1ccccc1=N3 |
| InChI | InChI=1S/C14H7N3O/c18-12-7-15-11-6-5-10-13(14(11)17-12)8-3-1-2-4-9(8)16-10/h1-7H |
| InChIKey | BGDGVRNPAAVCED-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 54.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.23 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze pyrazino[2,3-c]carbazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyrazino[2,3-c]carbazol-2-one?
The IUPAC name of pyrazino[2,3-c]carbazol-2-one (CID 148548388) is pyrazino[2,3-c]carbazol-2-one.
What is the SMILES notation for pyrazino[2,3-c]carbazol-2-one?
The canonical SMILES for pyrazino[2,3-c]carbazol-2-one is O=C1C=Nc2ccc3c(c2=N1)=c1ccccc1=N3.
What is the InChIKey of pyrazino[2,3-c]carbazol-2-one?
The InChIKey is BGDGVRNPAAVCED-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H7N3O/c18-12-7-15-11-6-5-10-13(14(11)17-12)8-3-1-2-4-9(8)16-10/h1-7H.
What are the key properties of pyrazino[2,3-c]carbazol-2-one?
pyrazino[2,3-c]carbazol-2-one has a molecular weight of 233.23 g/mol, XLogP of 1.10, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for pyrazino[2,3-c]carbazol-2-one is sourced from PubChem (CID 148548388), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).