C10H13N5O2 — CID 14854883
7-amino-1,3-diethylpyrimido[4,5-d]pyrimidine-2,4-dione (PubChem CID 14854883) has the molecular formula C10H13N5O2 and a molecular weight of 235.25 g/mol. Its IUPAC name is 7-amino-1,3-diethylpyrimido[4,5-d]pyrimidine-2,4-dione.
| Compound Name | 7-amino-1,3-diethylpyrimido[4,5-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 14854883 |
| Molecular Formula | C10H13N5O2 |
| Molecular Weight | 235.25 g/mol |
| Exact Mass | 235.11 |
| IUPAC Name | 7-amino-1,3-diethylpyrimido[4,5-d]pyrimidine-2,4-dione |
| SMILES | CCn1c(=O)c2cnc(N)nc2n(CC)c1=O |
| InChI | InChI=1S/C10H13N5O2/c1-3-14-7-6(5-12-9(11)13-7)8(16)15(4-2)10(14)17/h5H,3-4H2,1-2H3,(H2,11,12,13) |
| InChIKey | WLONDEDQSDUJGB-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 95.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.25 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |