C15H20O6 — CID 148550015
methyl (1S,4aS,7aS)-1-(1-ethoxyethoxy)-7-formyl-1,4a,5,7a-tetrahydrocyclopenta[c]pyran-4-carboxylate (PubChem CID 148550015) has the molecular formula C15H20O6 and a molecular weight of 296.32 g/mol. Its IUPAC name is methyl (1S,4aS,7aS)-1-(1-ethoxyethoxy)-7-formyl-1,4a,5,7a-tetrahydrocyclopenta[c]pyran-4-carboxylate.
| Compound Name | methyl (1S,4aS,7aS)-1-(1-ethoxyethoxy)-7-formyl-1,4a,5,7a-tetrahydrocyclopenta[c]pyran-4-carboxylate |
|---|---|
| PubChem CID | 148550015 |
| Molecular Formula | C15H20O6 |
| Molecular Weight | 296.32 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | methyl (1S,4aS,7aS)-1-(1-ethoxyethoxy)-7-formyl-1,4a,5,7a-tetrahydrocyclopenta[c]pyran-4-carboxylate |
| SMILES | CCOC(C)O[C@@H]1OC=C(C(=O)OC)[C@H]2CC=C(C=O)[C@@H]12 |
| InChI | InChI=1S/C15H20O6/c1-4-19-9(2)21-15-13-10(7-16)5-6-11(13)12(8-20-15)14(17)18-3/h5,7-9,11,13,15H,4,6H2,1-3H3/t9?,11-,13-,15+/m1/s1 |
| InChIKey | PDSBBQZUFGIJLZ-GBMZPYFASA-N |
| XLogP | 1.56 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.32 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|