C15H20O7 — CID 148550021
(1S,4aS,7aS)-1-(1-ethoxyethoxy)-4-methoxycarbonyl-1,4a,5,7a-tetrahydrocyclopenta[c]pyran-7-carboxylic acid (PubChem CID 148550021) has the molecular formula C15H20O7 and a molecular weight of 312.32 g/mol. Its IUPAC name is (1S,4aS,7aS)-1-(1-ethoxyethoxy)-4-methoxycarbonyl-1,4a,5,7a-tetrahydrocyclopenta[c]pyran-7-carboxylic acid.
| Compound Name | (1S,4aS,7aS)-1-(1-ethoxyethoxy)-4-methoxycarbonyl-1,4a,5,7a-tetrahydrocyclopenta[c]pyran-7-carboxylic acid |
|---|---|
| PubChem CID | 148550021 |
| Molecular Formula | C15H20O7 |
| Molecular Weight | 312.32 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | (1S,4aS,7aS)-1-(1-ethoxyethoxy)-4-methoxycarbonyl-1,4a,5,7a-tetrahydrocyclopenta[c]pyran-7-carboxylic acid |
| SMILES | CCOC(C)O[C@@H]1OC=C(C(=O)OC)[C@H]2CC=C(C(=O)O)[C@@H]12 |
| InChI | InChI=1S/C15H20O7/c1-4-20-8(2)22-15-12-9(5-6-10(12)13(16)17)11(7-21-15)14(18)19-3/h6-9,12,15H,4-5H2,1-3H3,(H,16,17)/t8?,9-,12+,15+/m1/s1 |
| InChIKey | HKYKNBDSWJGZPE-ZPUBMFOUSA-N |
| XLogP | 1.45 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.32 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|